CAS 1160256-33-6
:8-Chloro-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation. The presence of the 2-methylpropyl group attached to a phenyl ring contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. The chloro substituent at the 8-position of the quinoline ring may also enhance its biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C20H17Cl2NO
InChI:InChI=1S/C20H17Cl2NO/c1-12(2)10-13-6-8-14(9-7-13)18-11-16(20(22)24)15-4-3-5-17(21)19(15)23-18/h3-9,11-12H,10H2,1-2H3
InChI key:InChIKey=WSBGXTAHSJPQNY-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC(C)C)C=C3)C(Cl)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 8-chloro-2-[4-(2-methylpropyl)phenyl]-
- 8-Chloro-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.