CAS 1160256-40-5

7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:

7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and a carbonyl chloride functional group enhances its reactivity, making it useful in various chemical reactions, particularly in the synthesis of other compounds. The 3,4-dimethylphenyl substituent contributes to its hydrophobic characteristics, potentially influencing its solubility and biological activity. This compound may exhibit interesting pharmacological properties, as quinoline derivatives are often studied for their medicinal applications, including antimicrobial and antimalarial activities. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. However, handling this compound requires caution due to the presence of reactive functional groups, which may pose safety risks. Overall, 7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride represents a significant compound in the field of organic chemistry and medicinal research.

Formula: C₁₉H₁₅Cl₂NO

InChI: InChI=1S/C19H15Cl2NO/c1-10-4-5-13(8-11(10)2)17-9-15(19(21)23)14-6-7-16(20)12(3)18(14)22-17/h4-9H,1-3H3

InChI key: InChIKey=HVBUHSJCKQENAS-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(C)=C(C)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 7-chloro-2-(3,4-dimethylphenyl)-8-methyl-
• 7-Chloro-2-(3,4-dimethylphenyl)-8-methyl-4-quinolinecarbonyl chloride