CymitQuimica logo

CAS 1160256-42-7

:

8-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarbonyl chloride

Description:
8-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation. The presence of the 2,5-dimethylphenyl group contributes to its hydrophobic properties and may influence its biological activity. The chloro substituent can enhance the compound's reactivity, allowing for potential applications in organic synthesis and medicinal chemistry. Its molecular structure suggests potential uses in the development of pharmaceuticals or agrochemicals, particularly in the synthesis of more complex molecules. As with many chlorinated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this compound in laboratory settings.
Formula:C18H13Cl2NO
InChI:InChI=1S/C18H13Cl2NO/c1-10-6-7-11(2)13(8-10)16-9-14(18(20)22)12-4-3-5-15(19)17(12)21-16/h3-9H,1-2H3
InChI key:InChIKey=KVUXIWSDAVPVAD-UHFFFAOYSA-N
SMILES:CC1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3Cl)C=C(C)C=C1
Synonyms:
  • 8-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 8-chloro-2-(2,5-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.