CAS 1160256-50-7

8-Chloro-2-(3,4-dimethoxyphenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(3,4-dimethoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The dimethoxyphenyl group contributes to its potential for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. As a carbonyl chloride, it is likely to participate in acylation reactions and can act as a reactive electrophile in synthetic organic chemistry. The presence of multiple functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's stability and reactivity may be influenced by environmental factors such as temperature and pH. Overall, 8-Chloro-2-(3,4-dimethoxyphenyl)-4-quinolinecarbonyl chloride is a versatile compound with significant implications for research and development in chemical synthesis and drug discovery.

Formula: C₁₈H₁₃Cl₂NO₃

InChI: InChI=1S/C18H13Cl2NO3/c1-23-15-7-6-10(8-16(15)24-2)14-9-12(18(20)22)11-4-3-5-13(19)17(11)21-14/h3-9H,1-2H3

InChI key: InChIKey=OKKPBGFRIBKNAC-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC)=C(OC)C=C3)C(Cl)=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-chloro-2-(3,4-dimethoxyphenyl)-
• 8-Chloro-2-(3,4-dimethoxyphenyl)-4-quinolinecarbonyl chloride
• 4-quinolinecarbonyl chloride, 8-chloro-2-(3,4-dimethoxyphe
• 8-chloro-2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl chloride