CAS 1160256-59-6

8-Chloro-2-(3,4-dichlorophenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(3,4-dichlorophenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring system substituted with chlorine and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of chlorine atoms, which can participate in nucleophilic substitution reactions. The quinoline moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The carbonyl chloride group indicates that it can act as an acylating agent, which may facilitate the formation of amides or esters when reacted with nucleophiles. Additionally, the presence of multiple chlorine substituents can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₆H₇Cl₄NO

InChI: InChI=1S/C16H7Cl4NO/c17-11-5-4-8(6-13(11)19)14-7-10(16(20)22)9-2-1-3-12(18)15(9)21-14/h1-7H

InChI key: InChIKey=ZXZVNCSJJHOEDM-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(Cl)=C(Cl)C=C3)C(Cl)=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-chloro-2-(3,4-dichlorophenyl)-
• 8-Chloro-2-(3,4-dichlorophenyl)-4-quinolinecarbonyl chloride