CAS 1160256-71-2

7-Chloro-2-(2,4-dichlorophenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:

7-Chloro-2-(2,4-dichlorophenyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and multiple chlorine substituents. This compound typically exhibits properties associated with halogenated organic compounds, such as increased lipophilicity and potential biological activity. The presence of the carbonyl chloride functional group suggests it may be reactive, particularly towards nucleophiles, making it useful in various chemical synthesis applications. Its chlorinated phenyl groups may impart specific pharmacological properties, potentially influencing its interaction with biological targets. The compound's molecular structure indicates it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, due to the presence of chlorine atoms, it may also exhibit environmental persistence and toxicity, necessitating careful handling and assessment of its ecological impact. As with many synthetic compounds, its stability, solubility, and reactivity would depend on the specific conditions under which it is used or studied.

Formula: C₁₇H₉Cl₄NO

InChI: InChI=1S/C17H9Cl4NO/c1-8-13(19)5-4-10-12(17(21)23)7-15(22-16(8)10)11-3-2-9(18)6-14(11)20/h2-7H,1H3

InChI key: InChIKey=OYAKSESCPGINML-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(Cl)C=C(Cl)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 7-chloro-2-(2,4-dichlorophenyl)-8-methyl-
• 7-Chloro-2-(2,4-dichlorophenyl)-8-methyl-4-quinolinecarbonyl chloride