CAS 1160256-77-8
:8-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with a chloro group and a thienyl moiety. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation and nucleophilic substitution. The presence of the chloro substituent enhances its electrophilic character, while the thienyl group contributes to its aromatic properties and potential biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it is important to handle it with care due to the reactivity associated with acyl chlorides. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are crucial factors to consider in practical applications. Overall, 8-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride represents a versatile building block in organic synthesis and drug development.
Formula:C14H7Cl2NOS
InChI:InChI=1S/C14H7Cl2NOS/c15-10-4-1-3-8-9(14(16)18)7-11(17-13(8)10)12-5-2-6-19-12/h1-7H
InChI key:InChIKey=LUTIDETXSKYGJJ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CS3)C(Cl)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 8-chloro-2-(2-thienyl)-
- 8-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.