CAS 1160256-79-0
:7-Chloro-8-methyl-2-(2-thienyl)-4-quinolinecarbonyl chloride
Description:
7-Chloro-8-methyl-2-(2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group, a methyl group, and a thienyl moiety. This compound is typically used in medicinal chemistry and may exhibit biological activity due to its quinoline framework, which is known for its presence in various pharmaceuticals. The carbonyl chloride functional group suggests that it can participate in further chemical reactions, such as acylation or nucleophilic substitution, making it a versatile intermediate in organic synthesis. The presence of the thienyl group may also impart unique electronic properties and influence the compound's reactivity and solubility. Overall, this compound's characteristics, including its molecular structure and functional groups, position it as a potentially valuable compound in drug development and chemical research. However, specific safety and handling precautions should be observed due to the presence of reactive functional groups.
Formula:C15H9Cl2NOS
InChI:InChI=1S/C15H9Cl2NOS/c1-8-11(16)5-4-9-10(15(17)19)7-12(18-14(8)9)13-3-2-6-20-13/h2-7H,1H3
InChI key:InChIKey=RYYCHDHBVUHXEU-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CS3)C(C)=C(Cl)C=C2
Synonyms:- 7-Chloro-8-methyl-2-(2-thienyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.