CAS 1160256-80-3
:8-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a thienyl substituent, and a carbonyl chloride functional group. The presence of chlorine and the thienyl group contributes to its unique reactivity and potential biological activity. This compound is typically used in medicinal chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its chlorinated carbonyl group suggests it may participate in nucleophilic substitution reactions, making it a valuable building block in organic synthesis. The thienyl moiety can enhance lipophilicity and influence the compound's interaction with biological targets. As with many chlorinated compounds, appropriate safety measures should be taken during handling due to potential toxicity and environmental concerns. Overall, 8-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride exemplifies the intricate design often found in drug development, where structural modifications can lead to significant variations in biological activity.
Formula:C15H9Cl2NOS
InChI:InChI=1S/C15H9Cl2NOS/c1-8-5-6-13(20-8)12-7-10(15(17)19)9-3-2-4-11(16)14(9)18-12/h2-7H,1H3
InChI key:InChIKey=HHTCIGNEXUTOHM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(C)=CC3)C(Cl)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 8-chloro-2-(5-methyl-2-thienyl)-
- 8-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.