CAS 1160256-84-7

8-Chloro-2-(5-ethyl-2-thienyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(5-ethyl-2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a thienyl substituent, and a carbonyl chloride functional group. The presence of the chloro group at the 8-position of the quinoline ring enhances its reactivity, making it a potential candidate for various chemical transformations. The ethyl group on the thienyl ring contributes to the compound's hydrophobic characteristics, which may influence its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, which could be explored in medicinal chemistry. Additionally, the carbonyl chloride moiety suggests potential applications in acylation reactions or as a reactive intermediate in the synthesis of more complex molecules. Overall, the unique combination of functional groups and structural elements in 8-Chloro-2-(5-ethyl-2-thienyl)-4-quinolinecarbonyl chloride makes it a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₆H₁₁Cl₂NOS

InChI: InChI=1S/C16H11Cl2NOS/c1-2-9-6-7-14(21-9)13-8-11(16(18)20)10-4-3-5-12(17)15(10)19-13/h3-8H,2H2,1H3

InChI key: InChIKey=CUKGYXOCKHNXRM-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(CC)=CC3)C(Cl)=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-chloro-2-(5-ethyl-2-thienyl)-
• 8-Chloro-2-(5-ethyl-2-thienyl)-4-quinolinecarbonyl chloride