CAS 1160256-86-9
:7-Chloro-2-(5-ethyl-2-thienyl)-8-methyl-4-quinolinecarbonyl chloride
Description:
7-Chloro-2-(5-ethyl-2-thienyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a thienyl substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic molecules, such as moderate to high lipophilicity, which can influence its solubility in organic solvents. The presence of the chloro group may impart unique reactivity, making it a potential candidate for further chemical transformations. The thienyl group contributes to the compound's aromatic character, potentially affecting its electronic properties and reactivity. Additionally, the carbonyl chloride moiety suggests that it may participate in nucleophilic substitution reactions, making it useful in synthetic organic chemistry. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety and handling precautions should be observed due to the presence of reactive functional groups.
Formula:C17H13Cl2NOS
InChI:InChI=1S/C17H13Cl2NOS/c1-3-10-4-7-15(22-10)14-8-12(17(19)21)11-5-6-13(18)9(2)16(11)20-14/h4-8H,3H2,1-2H3
InChI key:InChIKey=QSWDPHXCYPWDLW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(CC)=CC3)C(C)=C(Cl)C=C2
Synonyms:- 7-Chloro-2-(5-ethyl-2-thienyl)-8-methyl-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 7-chloro-2-(5-ethyl-2-thienyl)-8-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.