CAS 1160256-88-1

8-Chloro-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a chloro substituent, and a furan ring. The presence of the chloro group indicates potential reactivity, particularly in nucleophilic substitution reactions. The furan moiety contributes to the compound's aromatic character and may influence its biological activity. This compound is likely to be a solid at room temperature, with properties such as solubility in organic solvents, which is typical for halogenated aromatic compounds. Its carbonyl chloride functional group suggests it can act as an acylating agent, making it useful in various chemical syntheses. The compound may exhibit interesting pharmacological properties, given the presence of both the quinoline and furan structures, which are often associated with biological activity. However, specific applications and biological effects would require further investigation through experimental studies. Safety data should be consulted due to the potential hazards associated with chlorinated compounds and reactive functional groups.

Formula: C₁₅H₉Cl₂NO₂

InChI: InChI=1S/C15H9Cl2NO2/c1-8-5-6-13(20-8)12-7-10(15(17)19)9-3-2-4-11(16)14(9)18-12/h2-7H,1H3

InChI key: InChIKey=WONAMKIPWWEVQV-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3OC(C)=CC3)C(Cl)=CC=C2

Synonyms:

• 8-Chloro-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-(5-methyl-2-furanyl)-