CAS 1160256-92-7

8-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a thienyl group. The presence of chlorine atoms in both the quinoline and thienyl rings contributes to its reactivity and potential biological activity. This compound is typically used in medicinal chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its carbonyl chloride functional group indicates that it can participate in acylation reactions, making it a versatile building block in organic synthesis. The compound's unique structural features may impart specific properties, such as lipophilicity and the ability to interact with biological targets, which are of interest in drug development. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 8-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride exemplifies the intricate relationship between molecular structure and chemical reactivity.

Formula: C₁₄H₆Cl₃NOS

InChI: InChI=1S/C14H6Cl3NOS/c15-9-3-1-2-7-8(14(17)19)6-10(18-13(7)9)11-4-5-12(16)20-11/h1-6H

InChI key: InChIKey=JRHWGQHQUOGFSM-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(Cl)=CC3)C(Cl)=CC=C2

Synonyms:

• 8-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-(5-chloro-2-thienyl)-