CAS 1160257-00-0

8-Chloro-3-methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-3-methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The quinoline ring contributes to its aromatic character, which can influence its solubility and stability in various solvents. The presence of the carbonyl chloride group suggests that it may participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. Additionally, the methyl and para-methylphenyl substituents can affect the compound's electronic properties and steric hindrance, which may influence its reactivity and interactions with biological targets. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₁₈H₁₃Cl₂NO

InChI: InChI=1S/C18H13Cl2NO/c1-10-6-8-12(9-7-10)16-11(2)15(18(20)22)13-4-3-5-14(19)17(13)21-16/h3-9H,1-2H3

InChI key: InChIKey=ACXUBVAKFPHICX-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1C)C3=CC=C(C)C=C3)C(Cl)=CC=C2

Synonyms:

• 8-Chloro-3-methyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-3-methyl-2-(4-methylphenyl)-