CAS 1160257-04-4
:8-Chloro-2-(4-chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(4-chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety substituted with chlorine and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased lipophilicity and potential biological activity. The presence of the chloro substituents may enhance its reactivity, particularly in nucleophilic substitution reactions. The carbonyl chloride group suggests that it can act as an acylating agent, making it useful in various synthetic applications, including the preparation of amides or esters. Additionally, compounds of this type may exhibit pharmacological properties, making them of interest in medicinal chemistry. However, due to the presence of chlorine atoms, it is essential to handle this compound with care, as it may pose environmental and health risks. Overall, the characteristics of this compound make it a valuable subject of study in both synthetic and medicinal chemistry contexts.
Formula:C17H10Cl3NO
InChI:InChI=1S/C17H10Cl3NO/c1-9-14(17(20)22)12-3-2-4-13(19)16(12)21-15(9)10-5-7-11(18)8-6-10/h2-8H,1H3
InChI key:InChIKey=INJDRYGFPUHNCM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1C)C3=CC=C(Cl)C=C3)C(Cl)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 8-chloro-2-(4-chlorophenyl)-3-methyl-
- 8-Chloro-2-(4-chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.