CAS 1160257-08-8
:8-Chloro-2-(3-chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(3-chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, chlorinated aromatic rings, and an acyl chloride functional group. This compound typically exhibits a yellow to brownish color and is soluble in organic solvents such as dichloromethane and acetone, but may have limited solubility in water due to its hydrophobic characteristics. The presence of chlorine atoms in its structure contributes to its potential reactivity, particularly in nucleophilic substitution reactions. As an acyl chloride, it is reactive towards amines and alcohols, making it useful in various synthetic applications, including the formation of amides and esters. Additionally, compounds of this type may exhibit biological activity, which could be of interest in pharmaceutical research. However, handling requires caution due to the potential toxicity associated with chlorinated compounds and the reactive nature of acyl chlorides. Proper safety protocols should be followed when working with this substance.
Formula:C17H10Cl3NO
InChI:InChI=1S/C17H10Cl3NO/c1-9-14(17(20)22)12-6-3-7-13(19)16(12)21-15(9)10-4-2-5-11(18)8-10/h2-8H,1H3
InChI key:InChIKey=HFAFKCPHTRKQMH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1C)C3=CC(Cl)=CC=C3)C(Cl)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 8-chloro-2-(3-chlorophenyl)-3-methyl-
- 8-Chloro-2-(3-chlorophenyl)-3-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.