CAS 1160257-12-4

6-Ethyl-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride

Description:

6-Ethyl-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring, an ethyl group, and a furan moiety. The presence of the carbonyl chloride functional group indicates that it is a reactive compound, likely used in synthetic organic chemistry for further derivatization or as an intermediate in the production of pharmaceuticals or agrochemicals. The furan ring contributes to its aromatic properties, potentially influencing its reactivity and interactions with biological systems. This compound may exhibit specific biological activities due to its unique structural features, making it of interest in medicinal chemistry. Its molecular weight, solubility, and stability would depend on the specific conditions under which it is handled. As with many chlorinated compounds, appropriate safety measures should be taken during handling due to potential toxicity and reactivity. Overall, 6-Ethyl-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride represents a valuable structure in the realm of synthetic organic chemistry.

Formula: C₁₇H₁₄ClNO₂

InChI: InChI=1S/C17H14ClNO2/c1-3-11-5-6-14-12(8-11)13(17(18)20)9-15(19-14)16-7-4-10(2)21-16/h4-9H,3H2,1-2H3

InChI key: InChIKey=RDLXRQSNCRQXIF-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)O3)C=CC(CC)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-ethyl-2-(5-methyl-2-furanyl)-
• 6-Ethyl-2-(5-methyl-2-furanyl)-4-quinolinecarbonyl chloride