CAS 1160257-16-8

6-Ethyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride

Description:

6-Ethyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with an ethyl group and a thienyl moiety. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation and nucleophilic substitution. The presence of the thienyl group, derived from thiophene, contributes to its potential biological activity and may influence its solubility and reactivity. The compound's molecular structure suggests it may exhibit interesting properties, including potential applications in pharmaceuticals or agrochemicals. Its reactivity as an acyl chloride allows for the introduction of various nucleophiles, making it a versatile intermediate in organic synthesis. As with many synthetic compounds, safety precautions should be observed due to the potential hazards associated with handling reactive chlorides. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₇H₁₄ClNOS

InChI: InChI=1S/C17H14ClNOS/c1-3-11-5-6-14-12(8-11)13(17(18)20)9-15(19-14)16-7-4-10(2)21-16/h4-9H,3H2,1-2H3

InChI key: InChIKey=HACLTKPSGKHZMX-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)S3)C=CC(CC)=C2

Synonyms:

• 6-Ethyl-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6-ethyl-2-(5-methyl-2-thienyl)-