CAS 1160257-20-4
:2-(5-Chloro-2-thienyl)-6-ethyl-4-quinolinecarbonyl chloride
Description:
2-(5-Chloro-2-thienyl)-6-ethyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety, a thienyl group, and a carbonyl chloride functional group. The presence of the chloro substituent on the thienyl ring contributes to its reactivity and potential applications in organic synthesis. The carbonyl chloride functional group indicates that this compound can participate in acylation reactions, making it useful in the synthesis of various derivatives. The ethyl group enhances the lipophilicity of the molecule, which may influence its biological activity and solubility properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activities often associated with quinoline derivatives. Additionally, the presence of multiple heteroatoms and functional groups suggests potential for diverse reactivity and interactions in chemical processes. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of reactive functional groups.
Formula:C16H11Cl2NOS
InChI:InChI=1S/C16H11Cl2NOS/c1-2-9-3-4-12-10(7-9)11(16(18)20)8-13(19-12)14-5-6-15(17)21-14/h3-8H,2H2,1H3
InChI key:InChIKey=WXFHTORNLNVNRN-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Cl)S3)C=CC(CC)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(5-chloro-2-thienyl)-6-ethyl-
- 2-(5-Chloro-2-thienyl)-6-ethyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.