CymitQuimica logo

CAS 1160257-22-6

:

2-(2,4-Dibromophenoxy)propanoyl chloride

Description:
2-(2,4-Dibromophenoxy)propanoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a propanoyl chloride moiety, which indicates the presence of a carbonyl group (C=O) adjacent to a chlorine atom, making it a reactive acyl chloride. The compound also features a 2,4-dibromophenoxy group, where the phenyl ring is substituted with two bromine atoms at the 2 and 4 positions, enhancing its reactivity and potentially influencing its biological activity. This compound is likely to be a solid at room temperature, with a relatively low solubility in water due to its hydrophobic aromatic structure. Its reactivity as an acyl chloride suggests it can participate in nucleophilic acyl substitution reactions, making it useful in organic synthesis, particularly in the formation of esters or amides. Additionally, the presence of bromine atoms may impart unique properties, such as increased lipophilicity or potential applications in medicinal chemistry. Safety precautions should be taken when handling this compound due to its reactive nature and potential toxicity.
Formula:C9H7Br2ClO2
InChI:InChI=1S/C9H7Br2ClO2/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3
InChI key:InChIKey=PBFBAJWNLKWKII-UHFFFAOYSA-N
SMILES:O(C(C(Cl)=O)C)C1=C(Br)C=C(Br)C=C1
Synonyms:
  • Propanoyl chloride, 2-(2,4-dibromophenoxy)-
  • 2-(2,4-Dibromophenoxy)propanoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.