CAS 1160257-24-8

2-(2-Chloro-5-methylphenoxy)propanoyl chloride

Description:

2-(2-Chloro-5-methylphenoxy)propanoyl chloride is an organic compound characterized by its functional groups, which include an acyl chloride and an ether. This compound features a chlorinated aromatic ring, specifically a 2-chloro-5-methylphenyl moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the propanoyl chloride group indicates that it can participate in acylation reactions, making it useful in the synthesis of various derivatives. The chlorinated aromatic structure may also impart unique properties such as increased lipophilicity and potential biological activity. As with many acyl chlorides, it is likely to be reactive with water, alcohols, and amines, leading to the formation of corresponding acids, esters, or amides. Safety precautions are essential when handling this compound due to its corrosive nature and potential to release hydrochloric acid upon hydrolysis. Overall, 2-(2-Chloro-5-methylphenoxy)propanoyl chloride is a versatile intermediate in chemical synthesis, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₀Cl₂O₂

InChI: InChI=1S/C10H10Cl2O2/c1-6-3-4-8(11)9(5-6)14-7(2)10(12)13/h3-5,7H,1-2H3

InChI key: InChIKey=SNGGCRDGXFFCJJ-UHFFFAOYSA-N

SMILES: O(C(C(Cl)=O)C)C1=C(Cl)C=CC(C)=C1

Synonyms:

• 2-(2-Chloro-5-methylphenoxy)propanoyl chloride
• Propanoyl chloride, 2-(2-chloro-5-methylphenoxy)-