CAS 1160257-26-0

2-(4-Bromo-2-chlorophenoxy)propanoyl chloride

Description:

2-(4-Bromo-2-chlorophenoxy)propanoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a propanoyl chloride moiety, which indicates the presence of a carbonyl group (C=O) adjacent to a chlorine atom, making it a reactive acyl chloride. The compound also features a phenoxy group, where a bromine and chlorine substituent are positioned on the aromatic ring, contributing to its reactivity and potential biological activity. The presence of halogens (bromine and chlorine) can influence the compound's physical properties, such as solubility and boiling point, as well as its reactivity in substitution reactions. This compound is likely to be used in organic synthesis, particularly in the preparation of more complex molecules, and may have applications in pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this substance, as acyl chlorides are known to be corrosive and can react vigorously with water, releasing hydrochloric acid.

Formula: C₉H₇BrCl₂O₂

InChI: InChI=1S/C9H7BrCl2O2/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3

InChI key: InChIKey=HHUKKTDKFVCCRU-UHFFFAOYSA-N

SMILES: O(C(C(Cl)=O)C)C1=C(Cl)C=C(Br)C=C1

Synonyms:

• Propanoyl chloride, 2-(4-bromo-2-chlorophenoxy)-
• 2-(4-Bromo-2-chlorophenoxy)propanoyl chloride