CAS 1160257-32-8
:2-[4-(1-Methylethyl)phenoxy]propanoyl chloride
Description:
2-[4-(1-Methylethyl)phenoxy]propanoyl chloride, identified by its CAS number 1160257-32-8, is an organic compound characterized by its functional groups and structural features. It contains a propanoyl chloride moiety, which indicates the presence of a carbonyl group (C=O) adjacent to a chlorine atom, making it a reactive acyl chloride. The compound also features a phenoxy group, which is derived from a phenol where a hydrogen atom is replaced by an alkoxy group, specifically a 4-(1-methylethyl)phenyl group, indicating a branched alkyl substituent on the aromatic ring. This structure contributes to its potential applications in organic synthesis, particularly in the formation of esters or amides. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical reactions, including acylation processes. As with many acyl chlorides, it is likely to be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, this compound is of interest in the field of synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C12H15ClO2
InChI:InChI=1S/C12H15ClO2/c1-8(2)10-4-6-11(7-5-10)15-9(3)12(13)14/h4-9H,1-3H3
InChI key:InChIKey=MYALTZDEXDDCTL-UHFFFAOYSA-N
SMILES:O(C(C(Cl)=O)C)C1=CC=C(C(C)C)C=C1
Synonyms:- 2-[4-(1-Methylethyl)phenoxy]propanoyl chloride
- Propanoyl chloride, 2-[4-(1-methylethyl)phenoxy]-
- 2-(4-isopropylphenoxy)propanoyl chloride
- 2-(4-propan-2-ylphenoxy)propanoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.