CAS 1160257-36-2
:2-[4-(1-Methyl-1-phenylethyl)phenoxy]propanoyl chloride
Description:
2-[4-(1-Methyl-1-phenylethyl)phenoxy]propanoyl chloride, identified by its CAS number 1160257-36-2, is an organic compound characterized by its functional groups and structural features. It contains a propanoyl chloride moiety, which indicates the presence of a carbonyl group (C=O) adjacent to a chlorine atom, making it a reactive acyl chloride. The compound also features a phenoxy group, which is derived from phenol, indicating that it has a phenyl ring bonded to an oxygen atom. The presence of the 1-methyl-1-phenylethyl substituent suggests that the compound has a bulky hydrophobic group, which may influence its solubility and reactivity. This compound is likely to be used in organic synthesis, particularly in the preparation of esters or amides, due to the reactivity of the acyl chloride functional group. As with many acyl chlorides, it may be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, its unique structure makes it a valuable intermediate in various chemical reactions.
Formula:C18H19ClO2
InChI:InChI=1S/C18H19ClO2/c1-13(17(19)20)21-16-11-9-15(10-12-16)18(2,3)14-7-5-4-6-8-14/h4-13H,1-3H3
InChI key:InChIKey=WYXOCFRLAKSQBU-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC=C(OC(C(Cl)=O)C)C=C1)C2=CC=CC=C2
Synonyms:- 2-[4-(1-Methyl-1-phenylethyl)phenoxy]propanoyl chloride
- Propanoyl chloride, 2-[4-(1-methyl-1-phenylethyl)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.