CymitQuimica logo

CAS 1160257-52-2

:

Butanoyl chloride, 2-(4-methylphenoxy)-

Description:
Butanoyl chloride, 2-(4-methylphenoxy)- is an organic compound characterized by the presence of a butanoyl group and a 4-methylphenoxy substituent. It is classified as an acyl chloride, which means it contains a carbonyl group (C=O) directly bonded to a chlorine atom. This structure makes it highly reactive, particularly with nucleophiles, and it is often used in organic synthesis for the formation of esters and amides. The presence of the 4-methylphenoxy group contributes to its chemical properties, potentially influencing its reactivity and solubility. Typically, compounds of this nature are colorless to pale yellow liquids with a pungent odor, and they are sensitive to moisture, reacting with water to produce hydrochloric acid and the corresponding carboxylic acid. Safety precautions are essential when handling this compound due to its corrosive nature and potential health hazards. Overall, butanoyl chloride, 2-(4-methylphenoxy)- serves as a valuable intermediate in the synthesis of various chemical products in the pharmaceutical and agrochemical industries.
Formula:C11H13ClO2
InChI:InChI=1S/C11H13ClO2/c1-3-10(11(12)13)14-9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3
InChI key:InChIKey=XWALUWSNMHPKSG-UHFFFAOYSA-N
SMILES:O(C(C(Cl)=O)CC)C1=CC=C(C)C=C1
Synonyms:
  • Butanoyl chloride, 2-(4-methylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.