CAS 1160257-60-2

2-(1-Naphthalenyloxy)butanoyl chloride

Description:

2-(1-Naphthalenyloxy)butanoyl chloride, with the CAS number 1160257-60-2, is an organic compound characterized by its functional groups, including an acyl chloride and an ether. This compound features a naphthalene moiety, which contributes to its aromatic properties and potential reactivity. The presence of the butanoyl group indicates that it is a derivative of butanoic acid, where the hydroxyl group has been replaced by a chlorine atom, enhancing its reactivity, particularly in nucleophilic acyl substitution reactions. The naphthalenyloxy group suggests that the compound may exhibit interesting electronic properties due to resonance stabilization. Typically, acyl chlorides are known for their high reactivity, especially towards nucleophiles, making them useful intermediates in organic synthesis, particularly in the formation of esters, amides, and other derivatives. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research and development. Safety precautions should be observed when handling this compound due to its reactive nature and potential hazards associated with acyl chlorides.

Formula: C₁₄H₁₃ClO₂

InChI: InChI=1S/C14H13ClO2/c1-2-12(14(15)16)17-13-9-5-7-10-6-3-4-8-11(10)13/h3-9,12H,2H2,1H3

InChI key: InChIKey=RERJKJSMEAWORN-UHFFFAOYSA-N

SMILES: O(C(C(Cl)=O)CC)C=1C2=C(C=CC1)C=CC=C2

Synonyms:

• 2-(1-Naphthyloxy)butanoyl chloride
• Butanoyl chloride, 2-(1-naphthalenyloxy)-
• 2-(1-Naphthalenyloxy)butanoyl chloride