CymitQuimica logo

CAS 1160257-76-0

:

2-Methyl-2-(3-methyl-4-nitrophenoxy)propanoyl chloride

Description:
2-Methyl-2-(3-methyl-4-nitrophenoxy)propanoyl chloride is an organic compound characterized by its functional groups and structural features. It contains an acyl chloride functional group, which is known for its reactivity, particularly in acylation reactions. The presence of a nitrophenyl moiety indicates that it may exhibit significant electronic effects due to the nitro group, which can influence its reactivity and interactions with other molecules. The methyl groups contribute to its hydrophobic character, potentially affecting its solubility in various solvents. This compound is likely to be a yellow or orange solid or liquid, typical of nitro-substituted aromatic compounds. It may be used in organic synthesis, particularly in the preparation of more complex molecules, and could serve as an intermediate in pharmaceuticals or agrochemicals. Safety precautions are essential when handling this compound due to the presence of the acyl chloride group, which can be corrosive and reactive with water, releasing hydrochloric acid.
Formula:C11H12ClNO4
InChI:InChI=1S/C11H12ClNO4/c1-7-6-8(4-5-9(7)13(15)16)17-11(2,3)10(12)14/h4-6H,1-3H3
InChI key:InChIKey=HKOCZYLMFJOKIS-UHFFFAOYSA-N
SMILES:O(C(C(Cl)=O)(C)C)C1=CC(C)=C(N(=O)=O)C=C1
Synonyms:
  • 2-Methyl-2-(3-methyl-4-nitrophenoxy)propanoyl chloride
  • Propanoyl chloride, 2-methyl-2-(3-methyl-4-nitrophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.