CAS 1160257-80-6

2-(3,4-Dimethylphenoxy)-2-methylpropanoyl chloride

Description:

2-(3,4-Dimethylphenoxy)-2-methylpropanoyl chloride, identified by its CAS number 1160257-80-6, is an organic compound characterized by the presence of a phenoxy group and an acyl chloride functional group. This compound features a 3,4-dimethyl-substituted phenyl ring, which contributes to its hydrophobic characteristics and potential reactivity. The acyl chloride functional group is known for its high reactivity, particularly in nucleophilic acyl substitution reactions, making it useful in organic synthesis for the introduction of acyl groups into various substrates. The presence of the methyl groups on the aromatic ring can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, due to the acyl chloride functionality, this compound may release hydrochloric acid upon reaction, necessitating careful handling and storage under appropriate conditions to prevent hydrolysis. Overall, this compound is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₅ClO₂

InChI: InChI=1S/C12H15ClO2/c1-8-5-6-10(7-9(8)2)15-12(3,4)11(13)14/h5-7H,1-4H3

InChI key: InChIKey=RSBPOYLRKIXBDV-UHFFFAOYSA-N

SMILES: O(C(C(Cl)=O)(C)C)C1=CC(C)=C(C)C=C1

Synonyms:

• 2-(3,4-Dimethylphenoxy)-2-methylpropanoyl chloride
• Propanoyl chloride, 2-(3,4-dimethylphenoxy)-2-methyl-