CAS 1160257-84-0

2-(2,5-Dichlorophenoxy)-2-methylpropanoyl chloride

Description:

2-(2,5-Dichlorophenoxy)-2-methylpropanoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a chlorinated aromatic ring, specifically a dichlorophenyl moiety, which contributes to its chemical reactivity and potential biological activity. The presence of the acyl chloride functional group indicates that it can undergo nucleophilic acyl substitution reactions, making it useful in organic synthesis for the introduction of acyl groups into other molecules. The compound's structure includes a branched alkyl chain, which can influence its solubility and reactivity. Generally, compounds like this may exhibit properties such as moderate volatility and potential toxicity, particularly due to the presence of chlorine atoms, which can affect environmental persistence and bioaccumulation. Safety precautions are essential when handling this substance, as acyl chlorides can be corrosive and may react violently with water, releasing hydrochloric acid. Overall, 2-(2,5-Dichlorophenoxy)-2-methylpropanoyl chloride is a specialized chemical with applications in synthetic chemistry and potentially in agrochemical formulations.

Formula: C₁₀H₉Cl₃O₂

InChI: InChI=1S/C10H9Cl3O2/c1-10(2,9(13)14)15-8-5-6(11)3-4-7(8)12/h3-5H,1-2H3

InChI key: InChIKey=GJAJDJVWUDNMOZ-UHFFFAOYSA-N

SMILES: O(C(C(Cl)=O)(C)C)C1=C(Cl)C=CC(Cl)=C1

Synonyms:

• Propanoyl chloride, 2-(2,5-dichlorophenoxy)-2-methyl-
• 2-(2,5-Dichlorophenoxy)-2-methylpropanoyl chloride