CAS 1160257-88-4
:2-[(2,3-Dihydro-1H-inden-5-yl)oxy]-2-methylpropanoyl chloride
Description:
2-[(2,3-Dihydro-1H-inden-5-yl)oxy]-2-methylpropanoyl chloride, identified by its CAS number 1160257-88-4, is an organic compound characterized by the presence of a chloroacetyl functional group attached to a branched alkyl chain. This compound features a dihydroindene moiety, which contributes to its unique structural and chemical properties. The presence of the chloro group indicates that it is a reactive acyl chloride, making it useful in various synthetic applications, particularly in the formation of esters and amides. The compound is likely to be a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its reactivity with water suggests that it should be handled with care, as it can hydrolyze to form the corresponding acid. Additionally, due to the presence of the indene structure, it may exhibit interesting biological or pharmacological properties, warranting further investigation in medicinal chemistry contexts. Proper safety measures should be taken when handling this compound, as it may pose health hazards.
Formula:C13H15ClO2
InChI:InChI=1S/C13H15ClO2/c1-13(2,12(14)15)16-11-7-6-9-4-3-5-10(9)8-11/h6-8H,3-5H2,1-2H3
InChI key:InChIKey=GVWQBKJUJKANEE-UHFFFAOYSA-N
SMILES:O(C(C(Cl)=O)(C)C)C=1C=C2C(=CC1)CCC2
Synonyms:- Propanoyl chloride, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-2-methyl-
- 2-[(2,3-Dihydro-1H-inden-5-yl)oxy]-2-methylpropanoyl chloride
- propanoyl chloride, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-2-m
- 2-(2,3-dihydro-1H-inden-5-yloxy)-2-methylpropanoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.