CAS 1160257-90-8

2-Methyl-2-[4-(1-methyl-1-phenylethyl)phenoxy]propanoyl chloride

Description:

2-Methyl-2-[4-(1-methyl-1-phenylethyl)phenoxy]propanoyl chloride, identified by its CAS number 1160257-90-8, is a synthetic organic compound characterized by its complex structure, which includes a propanoyl chloride moiety and a phenoxy group. This compound features a branched alkyl chain and aromatic rings, contributing to its potential reactivity and solubility properties. As a chlorinated compound, it is likely to exhibit reactivity typical of acyl chlorides, such as nucleophilic acyl substitution, making it useful in organic synthesis, particularly in the formation of esters or amides. The presence of the methyl and phenyl groups may influence its physical properties, such as boiling point and solubility in organic solvents. Additionally, due to the presence of chlorine, it may pose certain hazards, necessitating careful handling and storage. Overall, this compound is of interest in chemical research and may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further studies and evaluations of its biological activity and safety profile.

Formula: C₁₉H₂₁ClO₂

InChI: InChI=1S/C19H21ClO2/c1-18(2,14-8-6-5-7-9-14)15-10-12-16(13-11-15)22-19(3,4)17(20)21/h5-13H,1-4H3

InChI key: InChIKey=BTLAPTGCAGCZKC-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC=C(OC(C(Cl)=O)(C)C)C=C1)C2=CC=CC=C2

Synonyms:

• 2-Methyl-2-[4-(1-methyl-1-phenylethyl)phenoxy]propanoyl chloride
• Propanoyl chloride, 2-methyl-2-[4-(1-methyl-1-phenylethyl)phenoxy]-