CAS 1160259-93-7
:Benzoyl chloride, 3-[(4-bromophenyl)methoxy]-
Description:
Benzoyl chloride, 3-[(4-bromophenyl)methoxy]- is an organic compound characterized by the presence of a benzoyl chloride functional group and a methoxy group attached to a phenyl ring that is further substituted with a bromine atom. This compound typically appears as a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. It is known for its role as an acylating agent in organic synthesis, particularly in the formation of esters and amides. The presence of the bromine atom enhances its electrophilic character, making it more reactive towards nucleophiles. Additionally, the methoxy group can influence the compound's solubility and reactivity, often making it more lipophilic. Due to its reactive nature, benzoyl chloride derivatives are handled with care, as they can cause irritation to the skin and respiratory system. Proper safety measures, including the use of personal protective equipment, are essential when working with this compound in laboratory settings.
Formula:C14H10BrClO2
InChI:InChI=1S/C14H10BrClO2/c15-12-6-4-10(5-7-12)9-18-13-3-1-2-11(8-13)14(16)17/h1-8H,9H2
InChI key:InChIKey=VYRZOJIGHZBUPB-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(Br)C=C1)C2=CC(C(Cl)=O)=CC=C2
Synonyms:- 3-[(4-Bromobenzyl)oxy]benzoyl chloride
- Benzoyl chloride, 3-[(4-bromophenyl)methoxy]-
- 3-[(4-Bromophenyl)methoxy]benzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.