CAS 1160259-95-9

3-[(2-Methylphenyl)methoxy]benzoyl chloride

Description:

3-[(2-Methylphenyl)methoxy]benzoyl chloride, with the CAS number 1160259-95-9, is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy group attached to a substituted aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, particularly in the preparation of esters and amides. The methoxy group enhances its solubility in organic solvents, while the presence of the 2-methylphenyl group can influence its electronic properties and steric hindrance. As with many acyl chlorides, it is likely to be sensitive to moisture and can react vigorously with water, releasing hydrochloric acid. Proper handling and storage under an inert atmosphere are recommended to maintain its stability and reactivity.

Formula: C₁₅H₁₃ClO₂

InChI: InChI=1S/C15H13ClO2/c1-11-5-2-3-6-13(11)10-18-14-8-4-7-12(9-14)15(16)17/h2-9H,10H2,1H3

InChI key: InChIKey=WPQJSQCTJKIFIS-UHFFFAOYSA-N

SMILES: O(CC1=C(C)C=CC=C1)C2=CC(C(Cl)=O)=CC=C2

Synonyms:

• 3-[(2-Methylphenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 3-[(2-methylphenyl)methoxy]-