CAS 1160260-00-3

3-Ethoxy-4-[(2-fluorophenyl)methoxy]benzoyl chloride

Description:

3-Ethoxy-4-[(2-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and an ethoxy group. This compound features a fluorophenyl substituent, which can influence its reactivity and biological activity due to the presence of the fluorine atom. The benzoyl chloride functional group is known for its reactivity, particularly in acylation reactions, making this compound useful in synthetic organic chemistry. The ethoxy group contributes to the compound's solubility and can affect its interaction with biological systems. Additionally, the presence of multiple functional groups suggests potential applications in pharmaceuticals or agrochemicals, where such compounds may serve as intermediates or active ingredients. The compound's molecular structure and substituents can also influence its physical properties, such as melting point, boiling point, and solubility in various solvents. Overall, 3-Ethoxy-4-[(2-fluorophenyl)methoxy]benzoyl chloride is a versatile compound with significant implications in chemical synthesis and potential applications in various fields.

Formula: C₁₆H₁₄ClFO₃

InChI: InChI=1S/C16H14ClFO3/c1-2-20-15-9-11(16(17)19)7-8-14(15)21-10-12-5-3-4-6-13(12)18/h3-9H,2,10H2,1H3

InChI key: InChIKey=KHNYUFIGSIKARY-UHFFFAOYSA-N

SMILES: O(CC1=C(F)C=CC=C1)C2=C(OCC)C=C(C(Cl)=O)C=C2

Synonyms:

• Benzoyl chloride, 3-ethoxy-4-[(2-fluorophenyl)methoxy]-
• 3-Ethoxy-4-[(2-fluorophenyl)methoxy]benzoyl chloride