CAS 1160260-05-8

4-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride

Description:

4-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a benzoyl chloride moiety, which is known for its reactivity due to the presence of the acyl chloride functional group. The compound also features a methoxy group attached to a phenyl ring, which can influence its solubility and reactivity. The presence of chlorine and fluorine substituents on the aromatic ring can enhance its biological activity and lipophilicity, making it of interest in pharmaceutical applications. Typically, compounds like this may exhibit properties such as moderate to high stability under standard conditions, but they can be sensitive to moisture due to the acyl chloride group. Additionally, the compound may participate in nucleophilic substitution reactions, making it useful in synthetic organic chemistry. Safety precautions should be taken when handling this substance, as it may be corrosive and harmful upon exposure.

Formula: C₁₄H₉Cl₂FO₂

InChI: InChI=1S/C14H9Cl2FO2/c15-12-2-1-3-13(17)11(12)8-19-10-6-4-9(5-7-10)14(16)18/h1-7H,8H2

InChI key: InChIKey=FOJZJXGEWNIRHY-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(C(Cl)=O)C=C1)C2=C(Cl)C=CC=C2F

Synonyms:

• 4-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 4-[(2-chloro-6-fluorophenyl)methoxy]-