CAS 1160260-22-9

5-Chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride

Description:

5-Chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride, with the CAS number 1160260-22-9, is a chemical compound characterized by its complex structure, which includes a benzoyl chloride moiety and a methoxy group attached to a chlorinated phenyl ring. This compound typically exhibits properties associated with aromatic chlorides, such as reactivity towards nucleophiles due to the presence of the acyl chloride functional group. It is likely to be a solid at room temperature, with potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The presence of multiple chlorine atoms suggests it may have enhanced lipophilicity and biological activity. Additionally, the compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine substituents, which may affect its stability and interaction with other chemical species. Safety precautions should be taken when handling this compound, as it may be hazardous due to its reactive functional groups and potential toxicity.

Formula: C₁₄H₈Cl₄O₂

InChI: InChI=1S/C14H8Cl4O2/c15-9-2-4-13(10(6-9)14(18)19)20-7-8-1-3-11(16)12(17)5-8/h1-6H,7H2

InChI key: InChIKey=ORTLYGUSUPFWIL-UHFFFAOYSA-N

SMILES: O(CC1=CC(Cl)=C(Cl)C=C1)C2=C(C(Cl)=O)C=C(Cl)C=C2

Synonyms:

• Benzoyl chloride, 5-chloro-2-[(3,4-dichlorophenyl)methoxy]-
• 5-Chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride
• 5-chloro-2-[(3,4-dichlorobenzyl)oxy]benzoyl chloride