CAS 1160260-32-1
:5-Bromo-2-[(2,4-dichlorophenyl)methoxy]benzoyl chloride
Description:
5-Bromo-2-[(2,4-dichlorophenyl)methoxy]benzoyl chloride is a chemical compound characterized by its complex structure, which includes a benzoyl chloride moiety and a methoxy group attached to a dichlorophenyl ring. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity due to the presence of the bromine and chlorine substituents. The presence of the benzoyl chloride functional group suggests that it can participate in acylation reactions, making it useful in organic synthesis. Additionally, the methoxy group can influence the compound's solubility and reactivity, often enhancing its lipophilicity. The compound may also exhibit biological activity, which is common among halogenated aromatic compounds, potentially making it of interest in pharmaceutical research. Safety considerations should be taken into account due to the presence of halogens, which can pose environmental and health risks. Overall, 5-Bromo-2-[(2,4-dichlorophenyl)methoxy]benzoyl chloride is a versatile compound with applications in synthetic chemistry and potentially in medicinal chemistry.
Formula:C14H8BrCl3O2
InChI:InChI=1S/C14H8BrCl3O2/c15-9-2-4-13(11(5-9)14(18)19)20-7-8-1-3-10(16)6-12(8)17/h1-6H,7H2
InChI key:InChIKey=LZFBYQHZGSGRRP-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=C(Cl)C=C1)C2=C(C(Cl)=O)C=C(Br)C=C2
Synonyms:- 5-Bromo-2-[(2,4-dichlorophenyl)methoxy]benzoyl chloride
- Benzoyl chloride, 5-bromo-2-[(2,4-dichlorophenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.