CAS 1160260-33-2
:2-[(2,4-Dichlorophenyl)methoxy]-3-methoxybenzoyl chloride
Description:
2-[(2,4-Dichlorophenyl)methoxy]-3-methoxybenzoyl chloride, identified by its CAS number 1160260-33-2, is a chemical compound characterized by its complex structure, which includes a benzoyl chloride moiety and two methoxy groups. This compound features a dichlorophenyl group, which contributes to its potential biological activity and reactivity. The presence of the benzoyl chloride functional group indicates that it can participate in acylation reactions, making it useful in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties. Additionally, the dichlorophenyl substituent can affect the compound's stability and reactivity due to the electron-withdrawing nature of the chlorine atoms. Overall, this compound's unique combination of functional groups suggests potential applications in various chemical reactions and industries, although specific safety and handling guidelines should be followed due to the presence of reactive chloride functionality.
Formula:C15H11Cl3O3
InChI:InChI=1S/C15H11Cl3O3/c1-20-13-4-2-3-11(15(18)19)14(13)21-8-9-5-6-10(16)7-12(9)17/h2-7H,8H2,1H3
InChI key:InChIKey=ISUBMVMXXIDCSV-UHFFFAOYSA-N
SMILES:O(CC1=C(Cl)C=C(Cl)C=C1)C2=C(C(Cl)=O)C=CC=C2OC
Synonyms:- Benzoyl chloride, 2-[(2,4-dichlorophenyl)methoxy]-3-methoxy-
- 2-[(2,4-Dichlorophenyl)methoxy]-3-methoxybenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.