CAS 1160260-38-7

4-[(2-Chlorophenyl)methoxy]-3-ethoxybenzoyl chloride

Description:

4-[(2-Chlorophenyl)methoxy]-3-ethoxybenzoyl chloride, with the CAS number 1160260-38-7, is an organic compound characterized by its complex structure, which includes a benzoyl chloride moiety and two ether functionalities. This compound features a chlorinated phenyl group, which can influence its reactivity and solubility properties. The presence of the benzoyl chloride functional group indicates that it is likely to be reactive, particularly in nucleophilic substitution reactions, making it useful in various synthetic applications. The ethoxy and methoxy groups contribute to its overall hydrophobic character, potentially affecting its solubility in organic solvents. Additionally, the chlorophenyl substituent may impart specific biological activities, making this compound of interest in pharmaceutical research. Overall, its unique combination of functional groups suggests potential utility in organic synthesis and medicinal chemistry, although specific applications would depend on further studies and evaluations of its properties and reactivity.

Formula: C₁₆H₁₄Cl₂O₃

InChI: InChI=1S/C16H14Cl2O3/c1-2-20-15-9-11(16(18)19)7-8-14(15)21-10-12-5-3-4-6-13(12)17/h3-9H,2,10H2,1H3

InChI key: InChIKey=IIWVHYCEXWDZGH-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=C(OCC)C=C(C(Cl)=O)C=C2

Synonyms:

• Benzoyl chloride, 4-[(2-chlorophenyl)methoxy]-3-ethoxy-
• 4-[(2-Chlorophenyl)methoxy]-3-ethoxybenzoyl chloride
• 4-[(2-chlorobenzyl)oxy]-3-ethoxybenzoyl chloride