CAS 1160260-46-7

5-Chloro-2-[(3-fluorophenyl)methoxy]benzoyl chloride

Description:

5-Chloro-2-[(3-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups, including a benzoyl chloride moiety and a methoxy group attached to a chlorinated aromatic ring. This compound features a chloro substituent at the 5-position and a methoxy group linked to a 3-fluorophenyl group, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate to high reactivity due to the presence of the acyl chloride functional group, which is known for its ability to undergo nucleophilic substitution reactions. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its reactivity profile. This compound may be utilized in various synthetic applications, particularly in the development of pharmaceuticals or agrochemicals, where its reactivity can be harnessed for further functionalization. Safety precautions should be observed when handling this compound, as it may be hazardous due to its reactive nature.

Formula: C₁₄H₉Cl₂FO₂

InChI: InChI=1S/C14H9Cl2FO2/c15-10-4-5-13(12(7-10)14(16)18)19-8-9-2-1-3-11(17)6-9/h1-7H,8H2

InChI key: InChIKey=UWLBDQQFCLTQCS-UHFFFAOYSA-N

SMILES: O(CC1=CC(F)=CC=C1)C2=C(C(Cl)=O)C=C(Cl)C=C2

Synonyms:

• 5-Chloro-2-[(3-fluorophenyl)methoxy]benzoyl chloride
• Benzoyl chloride, 5-chloro-2-[(3-fluorophenyl)methoxy]-