CymitQuimica logo

CAS 1160260-50-3

:

3-Ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]benzoyl chloride

Description:
3-Ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]benzoyl chloride, with the CAS number 1160260-50-3, is a chemical compound characterized by its complex structure, which includes an ethoxy group, a trifluoromethyl-substituted phenyl moiety, and a benzoyl chloride functional group. This compound is likely to exhibit properties typical of aromatic chlorides, such as reactivity towards nucleophiles due to the presence of the acyl chloride functional group. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. Additionally, the ethoxy group can affect solubility and reactivity. The presence of multiple functional groups suggests that this compound could participate in various chemical reactions, including acylation and nucleophilic substitution. Overall, its unique structural features may confer specific properties that are valuable in synthetic chemistry and material science. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications.
Formula:C17H14ClF3O3
InChI:InChI=1S/C17H14ClF3O3/c1-2-23-15-9-12(16(18)22)6-7-14(15)24-10-11-4-3-5-13(8-11)17(19,20)21/h3-9H,2,10H2,1H3
InChI key:InChIKey=KRBRPWFTMAHSBF-UHFFFAOYSA-N
SMILES:O(CC1=CC(C(F)(F)F)=CC=C1)C2=C(OCC)C=C(C(Cl)=O)C=C2
Synonyms:
  • 3-Ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]benzoyl chloride
  • Benzoyl chloride, 3-ethoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.