CymitQuimica logo

CAS 1160260-57-0

:

2-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride

Description:
2-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups, which include a benzoyl chloride moiety and a methoxy group attached to a chlorofluorophenyl ring. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The chlorofluorophenyl group contributes to its potential applications in pharmaceuticals and agrochemicals, as halogenated aromatic compounds often exhibit unique biological activities. Additionally, the presence of chlorine and fluorine atoms can influence the compound's lipophilicity and stability, making it suitable for various synthetic pathways. Safety considerations are important when handling this compound, as it may be corrosive and can release harmful gases upon hydrolysis. Proper storage and handling protocols should be followed to ensure safety in laboratory environments.
Formula:C14H9Cl2FO2
InChI:InChI=1S/C14H9Cl2FO2/c15-11-5-3-6-12(17)10(11)8-19-13-7-2-1-4-9(13)14(16)18/h1-7H,8H2
InChI key:InChIKey=DXMVGMQMFSDVRJ-UHFFFAOYSA-N
SMILES:C(OC1=C(C(Cl)=O)C=CC=C1)C2=C(Cl)C=CC=C2F
Synonyms:
  • 2-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride
  • Benzoyl chloride, 2-[(2-chloro-6-fluorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.