CymitQuimica logo

CAS 1160260-69-4

:

3-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride

Description:
3-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a benzoyl chloride moiety, which is known for its reactivity due to the presence of the acyl chloride functional group. The compound also features a methoxy group attached to a phenyl ring, which can influence its solubility and reactivity. The presence of chlorine and fluorine substituents on the aromatic ring contributes to its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. This compound may be utilized in various chemical syntheses, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to act as an acylating agent. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of substituents. Safety data should be consulted for handling, as compounds with acyl chloride functionalities can be corrosive and may release harmful gases upon reaction with water or alcohols.
Formula:C14H9Cl2FO2
InChI:InChI=1S/C14H9Cl2FO2/c15-12-5-2-6-13(17)11(12)8-19-10-4-1-3-9(7-10)14(16)18/h1-7H,8H2
InChI key:InChIKey=SBPODVSNMAYSPJ-UHFFFAOYSA-N
SMILES:C(OC1=CC(C(Cl)=O)=CC=C1)C2=C(Cl)C=CC=C2F
Synonyms:
  • 3-[(2-Chloro-6-fluorophenyl)methoxy]benzoyl chloride
  • Benzoyl chloride, 3-[(2-chloro-6-fluorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.