CAS 1160260-77-4: 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-quinolinecarbonyl chloride
Description:2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a benzodioxin ring. This compound features a carbonyl chloride functional group, which makes it a reactive acyl chloride, allowing it to participate in various chemical reactions, particularly in acylation processes. The presence of the benzodioxin structure contributes to its potential biological activity, as many compounds containing this moiety exhibit interesting pharmacological properties. The compound is likely to be a solid at room temperature, with solubility in organic solvents, reflecting its aromatic character. Its reactivity as an acyl chloride suggests that it can be used in synthetic organic chemistry for the preparation of more complex molecules. Safety precautions should be taken when handling this compound due to the presence of the reactive carbonyl chloride group, which can release hydrochloric acid upon hydrolysis. Overall, this compound's unique structural features and reactivity make it a valuable intermediate in chemical synthesis and research.
Formula:C18H12ClNO3
InChI:InChI=1S/C18H12ClNO3/c19-18(21)13-10-15(20-14-4-2-1-3-12(13)14)11-5-6-16-17(9-11)23-8-7-22-16/h1-6,9-10H,7-8H2
InChI key:InChIKey=QIJBWABLTHWMFS-UHFFFAOYSA-N
SMILES:O=C(Cl)C1=CC(=NC=2C=CC=CC21)C=3C=CC=4OCCOC4C3
- Synonyms:
- 4-Quinolinecarbonyl chloride, 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-
- 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-quinolinecarbonyl chloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride REF: 10-F369073CAS: 1160260-77-4 | - - - | - - - | Discontinued product |
 | 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride REF: 3D-FD121473CAS: 1160260-77-4 | Min. 95% | - - - | Discontinued product |
2-(2,3-dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride
Ref: 10-F369073
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
2-(2,3-Dihydro-1,4-benzodioxin-6-yl)quinoline-4-carbonyl chloride
Ref: 3D-FD121473
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
