CAS 1160260-82-1

2-(2,5-Dimethyl-3-thienyl)-6-methyl-4-quinolinecarbonyl chloride

Description:

2-(2,5-Dimethyl-3-thienyl)-6-methyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring fused with a thienyl group. This compound features a carbonyl chloride functional group, which makes it reactive and suitable for various chemical transformations. The presence of multiple methyl groups contributes to its hydrophobic nature, influencing its solubility and interaction with biological systems. The thienyl moiety introduces sulfur into the structure, which can affect the compound's electronic properties and reactivity. This compound may exhibit interesting biological activities due to its unique structural features, making it a candidate for research in medicinal chemistry. Additionally, its reactivity as an acyl chloride allows for the formation of amides or esters when reacted with appropriate nucleophiles. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation through experimental studies.

Formula: C₁₇H₁₄ClNOS

InChI: InChI=1S/C17H14ClNOS/c1-9-4-5-15-13(6-9)14(17(18)20)8-16(19-15)12-7-10(2)21-11(12)3/h4-8H,1-3H3

InChI key: InChIKey=QWBGWMPVSKCONZ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)SC(C)=C3)C=CC(C)=C2

Synonyms:

• 2-(2,5-Dimethyl-3-thienyl)-6-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(2,5-dimethyl-3-thienyl)-6-methyl-