CAS 1160260-85-4
:2-(2,4-Dimethylphenyl)-6-ethyl-4-quinolinecarbonyl chloride
Description:
2-(2,4-Dimethylphenyl)-6-ethyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring system, a carbonyl chloride functional group, and a substituted aromatic ring. The presence of the carbonyl chloride group indicates that it is a reactive compound, often used in organic synthesis as an acylating agent. The dimethyl and ethyl substituents contribute to its hydrophobic nature, potentially influencing its solubility in organic solvents. This compound may exhibit biological activity due to its quinoline core, which is known for various pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. Additionally, the compound's reactivity and functional groups make it a candidate for further chemical transformations, which could lead to the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as carbonyl chlorides can be hazardous.
Formula:C20H18ClNO
InChI:InChI=1S/C20H18ClNO/c1-4-14-6-8-18-16(10-14)17(20(21)23)11-19(22-18)15-7-5-12(2)9-13(15)3/h5-11H,4H2,1-3H3
InChI key:InChIKey=JTINFIHHXSUEKY-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=C(C)C=C3)C=CC(CC)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(2,4-dimethylphenyl)-6-ethyl-
- 2-(2,4-Dimethylphenyl)-6-ethyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.