CAS 1160260-87-6: 6-Ethyl-2-(3-methoxyphenyl)-4-quinolinecarbonyl chloride
Description:6-Ethyl-2-(3-methoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features an ethyl group and a methoxyphenyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic acyl substitution reactions, making it a useful intermediate in organic synthesis. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological relevance of quinoline derivatives. The compound's solubility, stability, and reactivity can vary based on the solvent and conditions used, which are important considerations for its practical applications. As with many synthetic compounds, safety data and handling precautions should be observed, given the potential reactivity of the carbonyl chloride group. Overall, this compound represents a valuable entity for further research and development in chemical and pharmaceutical sciences.
Formula:C19H16ClNO2
InChI:InChI=1S/C19H16ClNO2/c1-3-12-7-8-17-15(9-12)16(19(20)22)11-18(21-17)13-5-4-6-14(10-13)23-2/h4-11H,3H2,1-2H3
InChI key:InChIKey=KGPFYBLYVKXPQU-UHFFFAOYSA-N
SMILES:O=C(Cl)C1=CC(=NC=2C=CC(=CC21)CC)C=3C=CC=C(OC)C3
- Synonyms:
- 4-Quinolinecarbonyl chloride, 6-ethyl-2-(3-methoxyphenyl)-
- 6-Ethyl-2-(3-methoxyphenyl)-4-quinolinecarbonyl chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-ethyl-2-(3-methoxyphenyl)quinoline-4-carbonyl chloride REF: 10-F369077CAS: 1160260-87-6 | - - - | - - - | Discontinued product |
![]() | 6-Ethyl-2-(3-methoxyphenyl)quinoline-4-carbonyl chloride REF: 3D-FE121477CAS: 1160260-87-6 | Min. 95% | - - - | Discontinued product |

6-ethyl-2-(3-methoxyphenyl)quinoline-4-carbonyl chloride
Ref: 10-F369077
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

6-Ethyl-2-(3-methoxyphenyl)quinoline-4-carbonyl chloride
- Alcohols
- Ethers
- Amino Acids (AA)
- Polycyclic Compounds
- See more categories
- Organic Halides
Ref: 3D-FE121477
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |