CAS 1160260-91-2
:2-(4-Chlorophenyl)-6-ethyl-4-quinolinecarbonyl chloride
Description:
2-(4-Chlorophenyl)-6-ethyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chlorophenyl group at the 2-position and an ethyl group at the 6-position of the quinoline ring, contributing to its unique chemical properties. The presence of the carbonyl chloride functional group indicates that it is a reactive acyl chloride, making it useful in various synthetic applications, particularly in the formation of amides and esters. The chlorinated phenyl group may enhance its biological activity and lipophilicity, potentially influencing its interactions in biological systems. This compound is likely to be of interest in medicinal chemistry and material science due to its structural features. As with many chlorinated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C18H13Cl2NO
InChI:InChI=1S/C18H13Cl2NO/c1-2-11-3-8-16-14(9-11)15(18(20)22)10-17(21-16)12-4-6-13(19)7-5-12/h3-10H,2H2,1H3
InChI key:InChIKey=WSNMGVFRZJOZNH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Cl)C=C3)C=CC(CC)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(4-chlorophenyl)-6-ethyl-
- 2-(4-Chlorophenyl)-6-ethyl-4-quinolinecarbonyl chloride
- 2-(4-chlorophenyl)-6-ethylquinoline-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.