CAS 1160261-00-6
:6-Ethyl-2-(3-methylphenyl)-4-quinolinecarbonyl chloride
Description:
6-Ethyl-2-(3-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This compound features an ethyl group and a 3-methylphenyl substituent, contributing to its unique properties and reactivity. The presence of the carbonyl chloride functional group indicates that it can participate in acylation reactions, making it useful in organic synthesis, particularly in the formation of amides or esters. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where quinoline derivatives are often explored for their biological activities. Additionally, the presence of the chlorine atom enhances its reactivity, allowing for further functionalization. As with many organic compounds, handling should be done with care, considering potential hazards associated with chlorinated compounds and their reactivity. Overall, 6-Ethyl-2-(3-methylphenyl)-4-quinolinecarbonyl chloride is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C19H16ClNO
InChI:InChI=1S/C19H16ClNO/c1-3-13-7-8-17-15(10-13)16(19(20)22)11-18(21-17)14-6-4-5-12(2)9-14/h4-11H,3H2,1-2H3
InChI key:InChIKey=ONFIPGQDVZTMPN-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(C)=CC=C3)C=CC(CC)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-ethyl-2-(3-methylphenyl)-
- 6-Ethyl-2-(3-methylphenyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.