CAS 1160261-11-9: 8-Ethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride
Description:8-Ethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system, an ethyl group, and a thienyl substituent. This compound features a carbonyl chloride functional group, which is known for its reactivity, particularly in acylation reactions. The presence of the quinoline moiety suggests potential biological activity, as many quinoline derivatives are known for their pharmacological properties. The thienyl group adds to the compound's complexity and may influence its electronic properties and reactivity. In terms of physical properties, while specific values such as melting point or boiling point are not provided, compounds of this nature typically exhibit moderate solubility in organic solvents. The compound's reactivity, particularly due to the carbonyl chloride, makes it useful in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules. Overall, 8-Ethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride is a versatile compound with applications in both research and industry.
Formula:C16H12ClNOS
InChI:InChI=1S/C16H12ClNOS/c1-2-10-5-3-6-11-12(16(17)19)9-13(18-15(10)11)14-7-4-8-20-14/h3-9H,2H2,1H3
InChI key:InChIKey=ZEGJRJLMFYRVBO-UHFFFAOYSA-N
SMILES:O=C(Cl)C1=CC(=NC=2C1=CC=CC2CC)C=3SC=CC3
- Synonyms:
- 4-Quinolinecarbonyl chloride, 8-ethyl-2-(2-thienyl)-
- 8-Ethyl-2-(2-thienyl)-4-quinolinecarbonyl chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 8-ethyl-2-(2-thienyl)quinoline-4-carbonyl chloride REF: 10-F369091CAS: 1160261-11-9 | - - - | - - - | Discontinued product |
![]() | 8-Ethyl-2-(2-thienyl)quinoline-4-carbonyl chloride REF: 3D-FE121491CAS: 1160261-11-9 | Min. 95% | - - - | Discontinued product |

8-ethyl-2-(2-thienyl)quinoline-4-carbonyl chloride
Ref: 10-F369091
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

8-Ethyl-2-(2-thienyl)quinoline-4-carbonyl chloride
Ref: 3D-FE121491
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |